Products 2481084-21-1
CAS 2481084-21-1 is the registry number for 2-Bromo-8-cyclopentyl-5-methylpyrido[2,3-d]pyrimidin-7(8H)-one, 95%. Offered by: Fluorochem. Available pack sizes: 100mg, 250mg.
2-bromo-8-cyclopentyl-5-methylpyrido[2,3-d]pyrimidin-7-one (CAS 2481084-21-1) is a chemical compound with the molecular formula C13H14BrN3O and a molecular weight of 308.17 g/mol. IUPAC name: 2-bromo-8-cyclopentyl-5-methylpyrido[2,3-d]pyrimidin-7-one. InChIKey: BHUULEMZPVOZNY-UHFFFAOYSA-N.
| Molecular formula | C13H14BrN3O |
|---|---|
| Molecular weight | 308.17 g/mol |
| IUPAC name | 2-bromo-8-cyclopentyl-5-methylpyrido[2,3-d]pyrimidin-7-one |
| InChIKey | BHUULEMZPVOZNY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)N(C2=NC(=NC=C12)Br)C3CCCC3 |
Computed by PubChem (NCBI)