CAS 2410309-70-3 appears in our catalog under these names: 2-(4-(4-Bromophenyl)-1H-pyrazol-1-yl)-N,N-dimethylacetamide, 97%, 97%, 2-(4-(4-Bromophenyl)-1H-pyrazol-1-yl)-N,N-dimethylacetamide, 97%. Offered by: Chemat, Ambeed. Available pack sizes: 1g, 5g, 25g, 100g.
2-[4-(4-bromophenyl)pyrazol-1-yl]-N,N-dimethylacetamide (CAS 2410309-70-3) is a chemical compound with the molecular formula C13H14BrN3O and a molecular weight of 308.17 g/mol. IUPAC name: 2-[4-(4-bromophenyl)pyrazol-1-yl]-N,N-dimethylacetamide. InChIKey: KNKNFOUBDWXUFN-UHFFFAOYSA-N.
| Molecular formula | C13H14BrN3O |
|---|---|
| Molecular weight | 308.17 g/mol |
| IUPAC name | 2-[4-(4-bromophenyl)pyrazol-1-yl]-N,N-dimethylacetamide |
| InChIKey | KNKNFOUBDWXUFN-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)CN1C=C(C=N1)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)