Products 1216013-63-6
CAS 1216013-63-6 is the registry number for Ethyl 4-chlorothieno[2,3-d]pyrimidine-5-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Ethyl 4-chlorothieno[2,3-d]pyrimidine-5-carboxylate (CAS 1216013-63-6) is a chemical compound with the molecular formula C9H7ClN2O2S and a molecular weight of 242.68 g/mol. IUPAC name: ethyl 4-chlorothieno[2,3-d]pyrimidine-5-carboxylate. InChIKey: MHFSKNOBTNLWKM-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O2S |
|---|---|
| Molecular weight | 242.68 g/mol |
| IUPAC name | ethyl 4-chlorothieno[2,3-d]pyrimidine-5-carboxylate |
| InChIKey | MHFSKNOBTNLWKM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CSC2=C1C(=NC=N2)Cl |
Computed by PubChem (NCBI)