CAS 1216050-56-4 appears in our catalog under these names: 3-Acetyl-4-methylbenzoic acid, 3-Acetyl-4-methylbenzoic acid, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 1g.
3-acetyl-4-methylbenzoic acid (CAS 1216050-56-4) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 178.18 g/mol. IUPAC name: 3-acetyl-4-methylbenzoic acid. InChIKey: XLXKREYXAYVPFU-UHFFFAOYSA-N.
| Molecular formula | C10H10O3 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | 3-acetyl-4-methylbenzoic acid |
| InChIKey | XLXKREYXAYVPFU-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)O)C(=O)C |
Computed by PubChem (NCBI)