CAS 1216060-79-5 is the registry number for 6-Chloro-1h-indole-3-sulfonyl chloride, 98%. Offered by: AmBeed. Available pack sizes: 1g.
6-chloro-1H-indole-3-sulfonyl chloride (CAS 1216060-79-5) is a chemical compound with the molecular formula C8H5Cl2NO2S and a molecular weight of 250.10 g/mol. IUPAC name: 6-chloro-1H-indole-3-sulfonyl chloride. InChIKey: LSBWUVXQQOOFSB-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2NO2S |
|---|---|
| Molecular weight | 250.10 g/mol |
| IUPAC name | 6-chloro-1H-indole-3-sulfonyl chloride |
| InChIKey | LSBWUVXQQOOFSB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)NC=C2S(=O)(=O)Cl |
Computed by PubChem (NCBI)