Products 1368133-54-3

CAS 1368133-54-3 is the registry number for 5-Chloro-1h-indole-3-sulfonyl chloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

5-chloro-1H-indole-3-sulfonyl chloride (CAS 1368133-54-3) is a chemical compound with the molecular formula C8H5Cl2NO2S and a molecular weight of 250.10 g/mol. IUPAC name: 5-chloro-1H-indole-3-sulfonyl chloride. InChIKey: POQFPVLKNKMPJW-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5Cl2NO2S
Molecular weight250.10 g/mol
IUPAC name5-chloro-1H-indole-3-sulfonyl chloride
InChIKeyPOQFPVLKNKMPJW-UHFFFAOYSA-N
SMILESC1=CC2=C(C=C1Cl)C(=CN2)S(=O)(=O)Cl

Computed by PubChem (NCBI)