Products 1549606-45-2

CAS 1549606-45-2 appears in our catalog under these names: 2-Chloro-4-(cyanomethyl)benzene-1-sulfonyl chloride, 2-Chloro-4-(cyanomethyl)benzene-1-sulfonyl chloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 1g.

2-chloro-4-(cyanomethyl)benzenesulfonyl chloride (CAS 1549606-45-2) is a chemical compound with the molecular formula C8H5Cl2NO2S and a molecular weight of 250.10 g/mol. IUPAC name: 2-chloro-4-(cyanomethyl)benzenesulfonyl chloride. InChIKey: BLQBCEZRDCNTOK-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5Cl2NO2S
Molecular weight250.10 g/mol
IUPAC name2-chloro-4-(cyanomethyl)benzenesulfonyl chloride
InChIKeyBLQBCEZRDCNTOK-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1CC#N)Cl)S(=O)(=O)Cl

Computed by PubChem (NCBI)