Products 1216114-70-3

CAS 1216114-70-3 is the registry number for 4-Isopropoxy-2,5-dimethylbenzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

2,5-dimethyl-4-propan-2-yloxybenzoic acid (CAS 1216114-70-3) is a chemical compound with the molecular formula C12H16O3 and a molecular weight of 208.25 g/mol. IUPAC name: 2,5-dimethyl-4-propan-2-yloxybenzoic acid. InChIKey: ZPNZSQFTTQQXTH-UHFFFAOYSA-N.

Identity
Molecular formulaC12H16O3
Molecular weight208.25 g/mol
IUPAC name2,5-dimethyl-4-propan-2-yloxybenzoic acid
InChIKeyZPNZSQFTTQQXTH-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1OC(C)C)C)C(=O)O

Computed by PubChem (NCBI)