CAS 1216114-70-3 is the registry number for 4-Isopropoxy-2,5-dimethylbenzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2,5-dimethyl-4-propan-2-yloxybenzoic acid (CAS 1216114-70-3) is a chemical compound with the molecular formula C12H16O3 and a molecular weight of 208.25 g/mol. IUPAC name: 2,5-dimethyl-4-propan-2-yloxybenzoic acid. InChIKey: ZPNZSQFTTQQXTH-UHFFFAOYSA-N.
| Molecular formula | C12H16O3 |
|---|---|
| Molecular weight | 208.25 g/mol |
| IUPAC name | 2,5-dimethyl-4-propan-2-yloxybenzoic acid |
| InChIKey | ZPNZSQFTTQQXTH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1OC(C)C)C)C(=O)O |
Computed by PubChem (NCBI)