Products 1216230-18-0
CAS 1216230-18-0 is the registry number for (1,3-Dioxaindan-5-yl)(cyclopentyl)methanol. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1,3-benzodioxol-5-yl(cyclopentyl)methanol (CAS 1216230-18-0) is a chemical compound with the molecular formula C13H16O3 and a molecular weight of 220.26 g/mol. IUPAC name: 1,3-benzodioxol-5-yl(cyclopentyl)methanol. InChIKey: HUEXNQXGJDCZDN-UHFFFAOYSA-N.
| Molecular formula | C13H16O3 |
|---|---|
| Molecular weight | 220.26 g/mol |
| IUPAC name | 1,3-benzodioxol-5-yl(cyclopentyl)methanol |
| InChIKey | HUEXNQXGJDCZDN-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)C(C2=CC3=C(C=C2)OCO3)O |
Computed by PubChem (NCBI)