Products 1216408-71-7

CAS 1216408-71-7 is the registry number for Indole-3-butyric Acid-d4, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 1mg.

Structural formula: {0} (CAS {1})

3,3,4,4-tetradeuterio-4-(1H-indol-3-yl)butanoic acid (CAS 1216408-71-7) is a chemical compound with the molecular formula C12H13NO2 and a molecular weight of 207.26 g/mol. IUPAC name: 3,3,4,4-tetradeuterio-4-(1H-indol-3-yl)butanoic acid. InChIKey: JTEDVYBZBROSJT-KHORGVISSA-N.

Identity
Molecular formulaC12H13NO2
Molecular weight207.26 g/mol
IUPAC name3,3,4,4-tetradeuterio-4-(1H-indol-3-yl)butanoic acid
InChIKeyJTEDVYBZBROSJT-KHORGVISSA-N
SMILES[2H]C([2H])(CC(=O)O)C([2H])([2H])C1=CNC2=CC=CC=C21

Computed by PubChem (NCBI)