CAS 1216408-71-7 is the registry number for Indole-3-butyric Acid-d4, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 1mg.
3,3,4,4-tetradeuterio-4-(1H-indol-3-yl)butanoic acid (CAS 1216408-71-7) is a chemical compound with the molecular formula C12H13NO2 and a molecular weight of 207.26 g/mol. IUPAC name: 3,3,4,4-tetradeuterio-4-(1H-indol-3-yl)butanoic acid. InChIKey: JTEDVYBZBROSJT-KHORGVISSA-N.
| Molecular formula | C12H13NO2 |
|---|---|
| Molecular weight | 207.26 g/mol |
| IUPAC name | 3,3,4,4-tetradeuterio-4-(1H-indol-3-yl)butanoic acid |
| InChIKey | JTEDVYBZBROSJT-KHORGVISSA-N |
| SMILES | [2H]C([2H])(CC(=O)O)C([2H])([2H])C1=CNC2=CC=CC=C21 |
Computed by PubChem (NCBI)