Products 1216432-56-2
CAS 1216432-56-2 appears in our catalog under these names: Hydroxychloroquine-d4 Sulfate, >95% (HPLC), Hydroxychloroquine–d4–1 sulfate, Hydroxychloroquine-d4-1 (sulfate), 98.0%. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg.
2-[[4-[(7-chloroquinolin-4-yl)amino]-1,1,2,2-tetradeuteriopentyl]-ethylamino]ethanol;sulfuric acid (CAS 1216432-56-2) is a chemical compound with the molecular formula C18H28ClN3O5S and a molecular weight of 438.0 g/mol. IUPAC name: 2-[[4-[(7-chloroquinolin-4-yl)amino]-1,1,2,2-tetradeuteriopentyl]-ethylamino]ethanol;sulfuric acid. InChIKey: JCBIVZZPXRZKTI-LINVOLBQSA-N.
| Molecular formula | C18H28ClN3O5S |
|---|---|
| Molecular weight | 438.0 g/mol |
| IUPAC name | 2-[[4-[(7-chloroquinolin-4-yl)amino]-1,1,2,2-tetradeuteriopentyl]-ethylamino]ethanol;sulfuric acid |
| InChIKey | JCBIVZZPXRZKTI-LINVOLBQSA-N |
| SMILES | [2H]C([2H])(CC(C)NC1=C2C=CC(=CC2=NC=C1)Cl)C([2H])([2H])N(CC)CCO.OS(=O)(=O)O |
Computed by PubChem (NCBI)