Products 747-36-4
CAS 747-36-4 appears in our catalog under these names: 2-((4-((7-Chloroquinolin-4-yl)amino)pentyl)(ethyl)amino)ethanol sulfate, 95%, 2-[4-[(7-chloroquinolin-4-yl)amino]pentyl-ethylamino]ethanol sulfuric acid, 99%, 99%, Hydroxychloroquine Sulfate, Hydroxychloroquine Sulfate, >95% (HPLC), Hydroxychloroquine Sulphate. Offered by: Fluorochem, Chemat, Chemat Brand, TRC, Mikromol. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 50mg, 1mg.
2-[4-[(7-chloroquinolin-4-yl)amino]pentyl-ethylamino]ethanol;sulfuric acid (CAS 747-36-4) is a chemical compound with the molecular formula C18H28ClN3O5S and a molecular weight of 434.0 g/mol. IUPAC name: 2-[4-[(7-chloroquinolin-4-yl)amino]pentyl-ethylamino]ethanol;sulfuric acid. InChIKey: JCBIVZZPXRZKTI-UHFFFAOYSA-N.
| Molecular formula | C18H28ClN3O5S |
|---|---|
| Molecular weight | 434.0 g/mol |
| IUPAC name | 2-[4-[(7-chloroquinolin-4-yl)amino]pentyl-ethylamino]ethanol;sulfuric acid |
| InChIKey | JCBIVZZPXRZKTI-UHFFFAOYSA-N |
| SMILES | CCN(CCCC(C)NC1=C2C=CC(=CC2=NC=C1)Cl)CCO.OS(=O)(=O)O |
Computed by PubChem (NCBI)