CAS 1854126-45-6 appears in our catalog under these names: Hydroxychloroquine-d4 Sulfate, Hydroxychloroquine–d4 (sulfate), Hydroxychloroquine-d4 (sulfate). Offered by: Chemat Brand, GLPBio, MedChemExpress. Available pack sizes: on request, 1mg, 500μg, Get quote.
2-[4-[(7-chloroquinolin-4-yl)amino]pentyl-ethylamino]-1,1,2,2-tetradeuterioethanol;sulfuric acid (CAS 1854126-45-6) is a chemical compound with the molecular formula C18H28ClN3O5S and a molecular weight of 438.0 g/mol. IUPAC name: 2-[4-[(7-chloroquinolin-4-yl)amino]pentyl-ethylamino]-1,1,2,2-tetradeuterioethanol;sulfuric acid. InChIKey: JCBIVZZPXRZKTI-ZYMFQSNRSA-N.
| Molecular formula | C18H28ClN3O5S |
|---|---|
| Molecular weight | 438.0 g/mol |
| IUPAC name | 2-[4-[(7-chloroquinolin-4-yl)amino]pentyl-ethylamino]-1,1,2,2-tetradeuterioethanol;sulfuric acid |
| InChIKey | JCBIVZZPXRZKTI-ZYMFQSNRSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])O)N(CC)CCCC(C)NC1=C2C=CC(=CC2=NC=C1)Cl.OS(=O)(=O)O |
Computed by PubChem (NCBI)