Products 1216496-15-9
CAS 1216496-15-9 appears in our catalog under these names: Pentyl-d11 Paraben, >95% (HPLC), Pentyl 4-hydroxybenzoate-d11. Offered by: TRC, MedChemExpress. Available pack sizes: 50mg, 5mg, 5 mg, 50 mg.
1,1,2,2,3,3,4,4,5,5,5-undecadeuteriopentyl 4-hydroxybenzoate (CAS 1216496-15-9) is a chemical compound with the molecular formula C12H16O3 and a molecular weight of 219.32 g/mol. IUPAC name: 1,1,2,2,3,3,4,4,5,5,5-undecadeuteriopentyl 4-hydroxybenzoate. InChIKey: ZNSSPLQZSUWFJT-YFJJFHRSSA-N.
| Molecular formula | C12H16O3 |
|---|---|
| Molecular weight | 219.32 g/mol |
| IUPAC name | 1,1,2,2,3,3,4,4,5,5,5-undecadeuteriopentyl 4-hydroxybenzoate |
| InChIKey | ZNSSPLQZSUWFJT-YFJJFHRSSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])OC(=O)C1=CC=C(C=C1)O |
Computed by PubChem (NCBI)