Products 1216619-15-6
CAS 1216619-15-6 appears in our catalog under these names: Desisopropyl Disopyramide Oxalate, >95% (HPLC), Desisopropyl disopyramide oxalate. Offered by: TRC, Biosynth. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 50mg.
Oxalic acid;2-phenyl-4-(propan-2-ylamino)-2-pyridin-2-ylbutanamide (CAS 1216619-15-6) is a chemical compound with the molecular formula C20H25N3O5 and a molecular weight of 387.4 g/mol. IUPAC name: oxalic acid;2-phenyl-4-(propan-2-ylamino)-2-pyridin-2-ylbutanamide. InChIKey: VZVCIBBRKTYOOA-UHFFFAOYSA-N.
| Molecular formula | C20H25N3O5 |
|---|---|
| Molecular weight | 387.4 g/mol |
| IUPAC name | oxalic acid;2-phenyl-4-(propan-2-ylamino)-2-pyridin-2-ylbutanamide |
| InChIKey | VZVCIBBRKTYOOA-UHFFFAOYSA-N |
| SMILES | CC(C)NCCC(C1=CC=CC=C1)(C2=CC=CC=N2)C(=O)N.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)