Products 2748157-34-6

CAS 2748157-34-6 is the registry number for AB–CHMINACA metabolite M7. Offered by: GLPBio. Available pack sizes: 1mg, 5mg, 500μg.

Structural formula: {0} (CAS {1})

2-[[1-(cyclohexylmethyl)indazole-3-carbonyl]amino]-3-methylbutanedioic acid (CAS 2748157-34-6) is a chemical compound with the molecular formula C20H25N3O5 and a molecular weight of 387.4 g/mol. IUPAC name: 2-[[1-(cyclohexylmethyl)indazole-3-carbonyl]amino]-3-methylbutanedioic acid. InChIKey: KORXLQCISNSYKQ-UHFFFAOYSA-N.

Identity
Molecular formulaC20H25N3O5
Molecular weight387.4 g/mol
IUPAC name2-[[1-(cyclohexylmethyl)indazole-3-carbonyl]amino]-3-methylbutanedioic acid
InChIKeyKORXLQCISNSYKQ-UHFFFAOYSA-N
SMILESCC(C(C(=O)O)NC(=O)C1=NN(C2=CC=CC=C21)CC3CCCCC3)C(=O)O

Computed by PubChem (NCBI)