Products 88269-33-4
CAS 88269-33-4 is the registry number for (2RS)-4-((1-Methylethyl)amino)-2-phenyl-2-(pyridin-2-yl)butanamide Hydrogen Oxalate. Offered by: Mikromol. Available pack sizes: 25mg.
Oxalic acid;2-phenyl-4-(propan-2-ylamino)-2-pyridin-2-ylbutanamide (CAS 88269-33-4) is a chemical compound with the molecular formula C20H25N3O5 and a molecular weight of 387.4 g/mol. IUPAC name: oxalic acid;2-phenyl-4-(propan-2-ylamino)-2-pyridin-2-ylbutanamide. InChIKey: VZVCIBBRKTYOOA-UHFFFAOYSA-N.
| Molecular formula | C20H25N3O5 |
|---|---|
| Molecular weight | 387.4 g/mol |
| IUPAC name | oxalic acid;2-phenyl-4-(propan-2-ylamino)-2-pyridin-2-ylbutanamide |
| InChIKey | VZVCIBBRKTYOOA-UHFFFAOYSA-N |
| SMILES | CC(C)NCCC(C1=CC=CC=C1)(C2=CC=CC=N2)C(=O)N.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)