CAS 1216671-39-4 is the registry number for Nitecapone-13C5. Offered by: TRC, Biosynth. Available pack sizes: 0,25mg, 0,5mg, 1mg.
3-[(3,4-dihydroxy-5-nitrophenyl)methylidene](1,2,3,4,5-13C5)pentane-2,4-dione (CAS 1216671-39-4) is a chemical compound with the molecular formula C12H11NO6 and a molecular weight of 270.18 g/mol. IUPAC name: 3-[(3,4-dihydroxy-5-nitrophenyl)methylidene](1,2,3,4,5-13C5)pentane-2,4-dione. InChIKey: UPMRZALMHVUCIN-VJQWXDCTSA-N.
| Molecular formula | C12H11NO6 |
|---|---|
| Molecular weight | 270.18 g/mol |
| IUPAC name | 3-[(3,4-dihydroxy-5-nitrophenyl)methylidene](1,2,3,4,5-13C5)pentane-2,4-dione |
| InChIKey | UPMRZALMHVUCIN-VJQWXDCTSA-N |
| SMILES | [13CH3][13C](=O)[13C](=CC1=CC(=C(C(=C1)O)O)[N+](=O)[O-])[13C](=O)[13CH3] |
Computed by PubChem (NCBI)