CAS 54808-56-9 is the registry number for Ethyl 4-(4-nitrophenyl)-2,4-dioxobutanoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Ethyl 4-(4-nitrophenyl)-2,4-dioxobutanoate (CAS 54808-56-9) is a chemical compound with the molecular formula C12H11NO6 and a molecular weight of 265.22 g/mol. IUPAC name: ethyl 4-(4-nitrophenyl)-2,4-dioxobutanoate. InChIKey: NHCJSIZCCDVCLU-UHFFFAOYSA-N.
| Molecular formula | C12H11NO6 |
|---|---|
| Molecular weight | 265.22 g/mol |
| IUPAC name | ethyl 4-(4-nitrophenyl)-2,4-dioxobutanoate |
| InChIKey | NHCJSIZCCDVCLU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)CC(=O)C1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)