Products 54808-56-9

CAS 54808-56-9 is the registry number for Ethyl 4-(4-nitrophenyl)-2,4-dioxobutanoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Ethyl 4-(4-nitrophenyl)-2,4-dioxobutanoate (CAS 54808-56-9) is a chemical compound with the molecular formula C12H11NO6 and a molecular weight of 265.22 g/mol. IUPAC name: ethyl 4-(4-nitrophenyl)-2,4-dioxobutanoate. InChIKey: NHCJSIZCCDVCLU-UHFFFAOYSA-N.

Identity
Molecular formulaC12H11NO6
Molecular weight265.22 g/mol
IUPAC nameethyl 4-(4-nitrophenyl)-2,4-dioxobutanoate
InChIKeyNHCJSIZCCDVCLU-UHFFFAOYSA-N
SMILESCCOC(=O)C(=O)CC(=O)C1=CC=C(C=C1)[N+](=O)[O-]

Computed by PubChem (NCBI)