CAS 73751-08-3 is the registry number for 5,5'-(Azanediylbis(methylene))bis(furan-2-carboxylic acid), 97%. Offered by: Chemat Brand. Available pack sizes: on request.
5-[[(5-carboxyfuran-2-yl)methylamino]methyl]furan-2-carboxylic acid (CAS 73751-08-3) is a chemical compound with the molecular formula C12H11NO6 and a molecular weight of 265.22 g/mol. IUPAC name: 5-[[(5-carboxyfuran-2-yl)methylamino]methyl]furan-2-carboxylic acid. InChIKey: UWWDIYIUNFBYPI-UHFFFAOYSA-N.
| Molecular formula | C12H11NO6 |
|---|---|
| Molecular weight | 265.22 g/mol |
| IUPAC name | 5-[[(5-carboxyfuran-2-yl)methylamino]methyl]furan-2-carboxylic acid |
| InChIKey | UWWDIYIUNFBYPI-UHFFFAOYSA-N |
| SMILES | C1=C(OC(=C1)C(=O)O)CNCC2=CC=C(O2)C(=O)O |
Computed by PubChem (NCBI)