CAS 1216683-89-4 is the registry number for 4-Methoxy-2,3,6-trimethylbenzaldehyde-d3. Offered by: TRC. Available pack sizes: 250mg, 25mg.
2,3,6-trimethyl-4-(trideuteriomethoxy)benzaldehyde (CAS 1216683-89-4) is a chemical compound with the molecular formula C11H14O2 and a molecular weight of 181.25 g/mol. IUPAC name: 2,3,6-trimethyl-4-(trideuteriomethoxy)benzaldehyde. InChIKey: BTOFIDLWQJCUJG-GKOSEXJESA-N.
| Molecular formula | C11H14O2 |
|---|---|
| Molecular weight | 181.25 g/mol |
| IUPAC name | 2,3,6-trimethyl-4-(trideuteriomethoxy)benzaldehyde |
| InChIKey | BTOFIDLWQJCUJG-GKOSEXJESA-N |
| SMILES | [2H]C([2H])([2H])OC1=C(C(=C(C(=C1)C)C=O)C)C |
Computed by PubChem (NCBI)