Products 1216710-83-6
CAS 1216710-83-6 appears in our catalog under these names: Xanthoanthrafil-d3, rac Xanthoanthrafil-d3. Offered by: Hubei YoungXin, TRC, Biosynth, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 5mg, 10 mg.
N-[(3,4-dimethoxyphenyl)methyl]-5-nitro-2-[(1,1,1-trideuterio-3-hydroxypropan-2-yl)amino]benzamide (CAS 1216710-83-6) is a chemical compound with the molecular formula C19H23N3O6 and a molecular weight of 392.4 g/mol. IUPAC name: N-[(3,4-dimethoxyphenyl)methyl]-5-nitro-2-[(1,1,1-trideuterio-3-hydroxypropan-2-yl)amino]benzamide. InChIKey: ZISFCTXLAXIEMV-FIBGUPNXSA-N.
| Molecular formula | C19H23N3O6 |
|---|---|
| Molecular weight | 392.4 g/mol |
| IUPAC name | N-[(3,4-dimethoxyphenyl)methyl]-5-nitro-2-[(1,1,1-trideuterio-3-hydroxypropan-2-yl)amino]benzamide |
| InChIKey | ZISFCTXLAXIEMV-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C(CO)NC1=C(C=C(C=C1)[N+](=O)[O-])C(=O)NCC2=CC(=C(C=C2)OC)OC |
Computed by PubChem (NCBI)
Synonyms:
rac Xanthoanthrafil-d3