CAS 247568-68-9 appears in our catalog under these names: Xanthoanthrafil Impurity 3, (R)-Xanthoanthrafil, >95% (HPLC), (R)-Xanthoanthrafil. Offered by: Hubei YoungXin, TRC, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 5mg, Get quote.
N-[(3,4-dimethoxyphenyl)methyl]-2-[[(2R)-1-hydroxypropan-2-yl]amino]-5-nitrobenzamide (CAS 247568-68-9) is a chemical compound with the molecular formula C19H23N3O6 and a molecular weight of 389.4 g/mol. IUPAC name: N-[(3,4-dimethoxyphenyl)methyl]-2-[[(2R)-1-hydroxypropan-2-yl]amino]-5-nitrobenzamide. InChIKey: ZISFCTXLAXIEMV-GFCCVEGCSA-N.
| Molecular formula | C19H23N3O6 |
|---|---|
| Molecular weight | 389.4 g/mol |
| IUPAC name | N-[(3,4-dimethoxyphenyl)methyl]-2-[[(2R)-1-hydroxypropan-2-yl]amino]-5-nitrobenzamide |
| InChIKey | ZISFCTXLAXIEMV-GFCCVEGCSA-N |
| SMILES | C[C@H](CO)NC1=C(C=C(C=C1)[N+](=O)[O-])C(=O)NCC2=CC(=C(C=C2)OC)OC |
Computed by PubChem (NCBI)