Products 58368-87-9
CAS 58368-87-9 appears in our catalog under these names: Nicardipine Methyl Amino Derivative, Nimodipine Impurity 16. Offered by: Chemat Brand. Available pack sizes: on request.
3-O-methyl 5-O-[2-(methylamino)ethyl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (CAS 58368-87-9) is a chemical compound with the molecular formula C19H23N3O6 and a molecular weight of 389.4 g/mol. IUPAC name: 3-O-methyl 5-O-[2-(methylamino)ethyl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate. InChIKey: ZYQSJVQRWNAWHO-UHFFFAOYSA-N.
| Molecular formula | C19H23N3O6 |
|---|---|
| Molecular weight | 389.4 g/mol |
| IUPAC name | 3-O-methyl 5-O-[2-(methylamino)ethyl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| InChIKey | ZYQSJVQRWNAWHO-UHFFFAOYSA-N |
| SMILES | CC1=C(C(C(=C(N1)C)C(=O)OCCNC)C2=CC(=CC=C2)[N+](=O)[O-])C(=O)OC |
Computed by PubChem (NCBI)
Synonyms:
Nimodipine Impurity 16