Products 1216788-76-9
CAS 1216788-76-9 appears in our catalog under these names: 3-Methoxy Dopamine-d4 Hydrochloride (Major), >95% (HPLC), 2-(4-Hydroxy-3-methoxyphenyl)ethyl-1,1,2,2-d4-amine HCl, 98 atom % D, min 98% Chemical Purity, 3-Methoxy Dopamine-d4 Hydrochloride, 3–Methoxytyramine–d4 hydrochloride, 3-Methoxytyramine-D4 HCl. Offered by: TRC, CDN, TargetMol, GLPBio, Biosynth. Available pack sizes: 10mg, 50mg, 0,05g, 0,01g, 1mg, 5mg, 25mg, 1x1ml.
4-(2-amino-1,1,2,2-tetradeuterioethyl)-2-methoxyphenol;hydrochloride (CAS 1216788-76-9) is a chemical compound with the molecular formula C9H14ClNO2 and a molecular weight of 207.69 g/mol. IUPAC name: 4-(2-amino-1,1,2,2-tetradeuterioethyl)-2-methoxyphenol;hydrochloride. InChIKey: AWRIOTVUTPLWLF-HGFPCDIYSA-N.
| Molecular formula | C9H14ClNO2 |
|---|---|
| Molecular weight | 207.69 g/mol |
| IUPAC name | 4-(2-amino-1,1,2,2-tetradeuterioethyl)-2-methoxyphenol;hydrochloride |
| InChIKey | AWRIOTVUTPLWLF-HGFPCDIYSA-N |
| SMILES | [2H]C([2H])(C1=CC(=C(C=C1)O)OC)C([2H])([2H])N.Cl |
Computed by PubChem (NCBI)
Synonyms:
3-Methoxy Dopamine-d4 Hydrochloride, 3-Methoxy Dopamine-d4 Hydrochloride (Major), 3-Methoxytyramine-d4 (hydrochloride), 4-(2-amino-1,1,2,2-tetradeuterioethyl)-2-methoxyphenol;hydrochloride, 3-Methoxytyramine-d4 Hydrochloride, 2-(4-Hydroxy-3-methoxyphenyl)ethyl-1,1,2,2-d4-amine hcl, orb2281049, 3-Methoxytyramine-d4 hydrochloride Solution in Methanol, 1000ug/mL