Products 1216840-94-6
CAS 1216840-94-6 appears in our catalog under these names: Doxylamine d5, Doxylamine-d5 Succinate, Doxylamine-d5 Succinate, >95% (HPLC), (±)-Doxylamine-d5 Succinate (phenyl-d5), 99 atom % D, min 98% Chemical Purity, Doxylamine D5 succinate. Offered by: Chemat Brand, TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 0,01g, 0,005g, 5mg, 5 mg, 1 mg.
Butanedioic acid;N,N-dimethyl-2-[1-(2,3,4,5,6-pentadeuteriophenyl)-1-pyridin-2-ylethoxy]ethanamine (CAS 1216840-94-6) is a chemical compound with the molecular formula C21H28N2O5 and a molecular weight of 393.5 g/mol. IUPAC name: butanedioic acid;N,N-dimethyl-2-[1-(2,3,4,5,6-pentadeuteriophenyl)-1-pyridin-2-ylethoxy]ethanamine. InChIKey: KBAUFVUYFNWQFM-NBTFKYQWSA-N.
| Molecular formula | C21H28N2O5 |
|---|---|
| Molecular weight | 393.5 g/mol |
| IUPAC name | butanedioic acid;N,N-dimethyl-2-[1-(2,3,4,5,6-pentadeuteriophenyl)-1-pyridin-2-ylethoxy]ethanamine |
| InChIKey | KBAUFVUYFNWQFM-NBTFKYQWSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C(C)(C2=CC=CC=N2)OCCN(C)C)[2H])[2H].C(CC(=O)O)C(=O)O |
Computed by PubChem (NCBI)