Products 2590744-14-0

CAS 2590744-14-0 is the registry number for 2-Benzyl 8-(tert-butyl) 4-oxo-2,8-diazaspiro[4.5]decane-2,8-dicarboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

2-O-benzyl 8-O-tert-butyl 4-oxo-2,8-diazaspiro[4.5]decane-2,8-dicarboxylate (CAS 2590744-14-0) is a chemical compound with the molecular formula C21H28N2O5 and a molecular weight of 388.5 g/mol. IUPAC name: 2-O-benzyl 8-O-tert-butyl 4-oxo-2,8-diazaspiro[4.5]decane-2,8-dicarboxylate. InChIKey: AWEHJBUKCJIQDW-UHFFFAOYSA-N.

Identity
Molecular formulaC21H28N2O5
Molecular weight388.5 g/mol
IUPAC name2-O-benzyl 8-O-tert-butyl 4-oxo-2,8-diazaspiro[4.5]decane-2,8-dicarboxylate
InChIKeyAWEHJBUKCJIQDW-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC2(CC1)CN(CC2=O)C(=O)OCC3=CC=CC=C3

Computed by PubChem (NCBI)