Products 2007920-00-3

CAS 2007920-00-3 is the registry number for 8-Benzyl 1-tert-butyl 2-oxo-1,8-diazaspiro[4.5]decane-1,8-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

8-O-benzyl 1-O-tert-butyl 2-oxo-1,8-diazaspiro[4.5]decane-1,8-dicarboxylate (CAS 2007920-00-3) is a chemical compound with the molecular formula C21H28N2O5 and a molecular weight of 388.5 g/mol. IUPAC name: 8-O-benzyl 1-O-tert-butyl 2-oxo-1,8-diazaspiro[4.5]decane-1,8-dicarboxylate. InChIKey: GNGIBMWWCYZLQY-UHFFFAOYSA-N.

Identity
Molecular formulaC21H28N2O5
Molecular weight388.5 g/mol
IUPAC name8-O-benzyl 1-O-tert-butyl 2-oxo-1,8-diazaspiro[4.5]decane-1,8-dicarboxylate
InChIKeyGNGIBMWWCYZLQY-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1C(=O)CCC12CCN(CC2)C(=O)OCC3=CC=CC=C3

Computed by PubChem (NCBI)