CAS 1216863-00-1 is the registry number for 4-Azido-1-hydroxy-2,2,6,6-tetramethylpiperidine. Offered by: TRC. Available pack sizes: 1g.
4-azido-1-hydroxy-2,2,6,6-tetramethylpiperidine (CAS 1216863-00-1) is a chemical compound with the molecular formula C9H18N4O and a molecular weight of 198.27 g/mol. IUPAC name: 4-azido-1-hydroxy-2,2,6,6-tetramethylpiperidine. InChIKey: NYMAVUZUFMNQIL-UHFFFAOYSA-N.
| Molecular formula | C9H18N4O |
|---|---|
| Molecular weight | 198.27 g/mol |
| IUPAC name | 4-azido-1-hydroxy-2,2,6,6-tetramethylpiperidine |
| InChIKey | NYMAVUZUFMNQIL-UHFFFAOYSA-N |
| SMILES | CC1(CC(CC(N1O)(C)C)N=[N+]=[N-])C |
Computed by PubChem (NCBI)