CAS 1247575-52-5 is the registry number for 2-(Azidomethyl)-4-(2-methylpropyl)morpholine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(azidomethyl)-4-(2-methylpropyl)morpholine (CAS 1247575-52-5) is a chemical compound with the molecular formula C9H18N4O and a molecular weight of 198.27 g/mol. IUPAC name: 2-(azidomethyl)-4-(2-methylpropyl)morpholine. InChIKey: XVWVCOFXLLYADM-UHFFFAOYSA-N.
| Molecular formula | C9H18N4O |
|---|---|
| Molecular weight | 198.27 g/mol |
| IUPAC name | 2-(azidomethyl)-4-(2-methylpropyl)morpholine |
| InChIKey | XVWVCOFXLLYADM-UHFFFAOYSA-N |
| SMILES | CC(C)CN1CCOC(C1)CN=[N+]=[N-] |
Computed by PubChem (NCBI)