CAS 78151-25-4 is the registry number for 3-(Azidomethyl)-2,2,5,5-tetramethyl-1-pyrrolidinyloxy, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg.
3-(azidomethyl)-1-hydroxy-2,2,5,5-tetramethylpyrrolidine (CAS 78151-25-4) is a chemical compound with the molecular formula C9H18N4O and a molecular weight of 198.27 g/mol. IUPAC name: 3-(azidomethyl)-1-hydroxy-2,2,5,5-tetramethylpyrrolidine. InChIKey: OOZJHQLYZLXPIF-UHFFFAOYSA-N.
| Molecular formula | C9H18N4O |
|---|---|
| Molecular weight | 198.27 g/mol |
| IUPAC name | 3-(azidomethyl)-1-hydroxy-2,2,5,5-tetramethylpyrrolidine |
| InChIKey | OOZJHQLYZLXPIF-UHFFFAOYSA-N |
| SMILES | CC1(CC(C(N1O)(C)C)CN=[N+]=[N-])C |
Computed by PubChem (NCBI)