Products 1216866-96-4
CAS 1216866-96-4 appears in our catalog under these names: 5-Cyano-6-methylnicotinic acid, 95%, 5-Cyano-6-methylnicotinic acid, 98+%, 5-Cyano-6-methylnicotinic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 10g, 0,5g, 5g.
5-cyano-6-methylpyridine-3-carboxylic acid (CAS 1216866-96-4) is a chemical compound with the molecular formula C8H6N2O2 and a molecular weight of 162.15 g/mol. IUPAC name: 5-cyano-6-methylpyridine-3-carboxylic acid. InChIKey: DIHBEWMXYDGNED-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2 |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | 5-cyano-6-methylpyridine-3-carboxylic acid |
| InChIKey | DIHBEWMXYDGNED-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=N1)C(=O)O)C#N |
Computed by PubChem (NCBI)