CAS 1216892-47-5 appears in our catalog under these names: 5H,6H,7H,8H-Imidazo(1,2-a)pyridine-3-sulfonyl Chloride (~85%), 5,6,7,8-Tetrahydroimidazo(1,2-a)-pyridine-3-sulfonyl chloride. Offered by: TRC, Biosynth. Available pack sizes: 250mg, 25mg, 50mg, 100mg, 1g.
5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-3-sulfonyl chloride (CAS 1216892-47-5) is a chemical compound with the molecular formula C7H9ClN2O2S and a molecular weight of 220.68 g/mol. IUPAC name: 5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-3-sulfonyl chloride. InChIKey: WOCAAWOBBCHYDI-UHFFFAOYSA-N.
| Molecular formula | C7H9ClN2O2S |
|---|---|
| Molecular weight | 220.68 g/mol |
| IUPAC name | 5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-3-sulfonyl chloride |
| InChIKey | WOCAAWOBBCHYDI-UHFFFAOYSA-N |
| SMILES | C1CCN2C(=NC=C2S(=O)(=O)Cl)C1 |
Computed by PubChem (NCBI)