CAS 1443980-37-7 is the registry number for 5,6,7,8-Tetrahydroimidazo(1,2-a)pyridine-2-sulfonyl chloride, 97%. Offered by: AmBeed. Available pack sizes: 1g.
5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-sulfonyl chloride (CAS 1443980-37-7) is a chemical compound with the molecular formula C7H9ClN2O2S and a molecular weight of 220.68 g/mol. IUPAC name: 5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-sulfonyl chloride. InChIKey: FTEDHFJCOKFOHL-UHFFFAOYSA-N.
| Molecular formula | C7H9ClN2O2S |
|---|---|
| Molecular weight | 220.68 g/mol |
| IUPAC name | 5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-sulfonyl chloride |
| InChIKey | FTEDHFJCOKFOHL-UHFFFAOYSA-N |
| SMILES | C1CCN2C=C(N=C2C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)