Products 91783-85-6
CAS 91783-85-6 is the registry number for 5-Amino-2-chloro-N-methylbenzenesulfonamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
5-amino-2-chloro-N-methylbenzenesulfonamide (CAS 91783-85-6) is a chemical compound with the molecular formula C7H9ClN2O2S and a molecular weight of 220.68 g/mol. IUPAC name: 5-amino-2-chloro-N-methylbenzenesulfonamide. InChIKey: VVVUSJRGJKWHRV-UHFFFAOYSA-N.
| Molecular formula | C7H9ClN2O2S |
|---|---|
| Molecular weight | 220.68 g/mol |
| IUPAC name | 5-amino-2-chloro-N-methylbenzenesulfonamide |
| InChIKey | VVVUSJRGJKWHRV-UHFFFAOYSA-N |
| SMILES | CNS(=O)(=O)C1=C(C=CC(=C1)N)Cl |
Computed by PubChem (NCBI)