Products 1216927-29-5
CAS 1216927-29-5 appears in our catalog under these names: rac Fenfluramine-d5 Hydrochloride, >95% (HPLC), (±)-Fenfluramine-d5 HCl (N-ethyl-d5), 98 atom % D, min 98% Chemical Purity, rac Fenfluramine-d5 hydrochloride. Offered by: TRC, CDN, Biosynth. Available pack sizes: 10mg, 1mg, 0,01g, 0,005g, 5mg, 25mg, 50mg.
N-(1,1,2,2,2-pentadeuterioethyl)-1-[3-(trifluoromethyl)phenyl]propan-2-amine;hydrochloride (CAS 1216927-29-5) is a chemical compound with the molecular formula C12H17ClF3N and a molecular weight of 272.75 g/mol. IUPAC name: N-(1,1,2,2,2-pentadeuterioethyl)-1-[3-(trifluoromethyl)phenyl]propan-2-amine;hydrochloride. InChIKey: ZXKXJHAOUFHNAS-IYSLTCQOSA-N.
| Molecular formula | C12H17ClF3N |
|---|---|
| Molecular weight | 272.75 g/mol |
| IUPAC name | N-(1,1,2,2,2-pentadeuterioethyl)-1-[3-(trifluoromethyl)phenyl]propan-2-amine;hydrochloride |
| InChIKey | ZXKXJHAOUFHNAS-IYSLTCQOSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])NC(C)CC1=CC(=CC=C1)C(F)(F)F.Cl |
Computed by PubChem (NCBI)