CAS 667916-89-4 appears in our catalog under these names: 3-(4-(Trifluoromethyl)phenyl)pentan-3-amine hydrochloride, 3-(4-(Trifluoromethyl)phenyl)pentan-3-amine hydrochloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 5g.
3-[4-(trifluoromethyl)phenyl]pentan-3-amine;hydrochloride (CAS 667916-89-4) is a chemical compound with the molecular formula C12H17ClF3N and a molecular weight of 267.72 g/mol. IUPAC name: 3-[4-(trifluoromethyl)phenyl]pentan-3-amine;hydrochloride. InChIKey: DEJSGSPPVHKQMU-UHFFFAOYSA-N.
| Molecular formula | C12H17ClF3N |
|---|---|
| Molecular weight | 267.72 g/mol |
| IUPAC name | 3-[4-(trifluoromethyl)phenyl]pentan-3-amine;hydrochloride |
| InChIKey | DEJSGSPPVHKQMU-UHFFFAOYSA-N |
| SMILES | CCC(CC)(C1=CC=C(C=C1)C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)