CAS 1439896-35-1 is the registry number for 2,2-Dimethyl-3-[3-(trifluoromethyl)phenyl]propan-1-amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
2,2-dimethyl-3-[3-(trifluoromethyl)phenyl]propan-1-amine;hydrochloride (CAS 1439896-35-1) is a chemical compound with the molecular formula C12H17ClF3N and a molecular weight of 267.72 g/mol. IUPAC name: 2,2-dimethyl-3-[3-(trifluoromethyl)phenyl]propan-1-amine;hydrochloride. InChIKey: XQUPVLORCGYHIP-UHFFFAOYSA-N.
| Molecular formula | C12H17ClF3N |
|---|---|
| Molecular weight | 267.72 g/mol |
| IUPAC name | 2,2-dimethyl-3-[3-(trifluoromethyl)phenyl]propan-1-amine;hydrochloride |
| InChIKey | XQUPVLORCGYHIP-UHFFFAOYSA-N |
| SMILES | CC(C)(CC1=CC(=CC=C1)C(F)(F)F)CN.Cl |
Computed by PubChem (NCBI)