CAS 1217-80-7 appears in our catalog under these names: 2-(2-Phenyl-1h-indol-3-yl)ethanamine, 95%, 2-(2-Phenyl-1H-indol-3-yl)ethanamine, 95+%, 2–(2–Phenyl–1H–indol–3–yl)ethanamine. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 100mg, 1g, 250mg.
2-(2-phenyl-1H-indol-3-yl)ethanamine (CAS 1217-80-7) is a chemical compound with the molecular formula C16H16N2 and a molecular weight of 236.31 g/mol. IUPAC name: 2-(2-phenyl-1H-indol-3-yl)ethanamine. InChIKey: HQJIMWXWTRWIAL-UHFFFAOYSA-N.
| Molecular formula | C16H16N2 |
|---|---|
| Molecular weight | 236.31 g/mol |
| IUPAC name | 2-(2-phenyl-1H-indol-3-yl)ethanamine |
| InChIKey | HQJIMWXWTRWIAL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C3=CC=CC=C3N2)CCN |
Computed by PubChem (NCBI)