CAS 6705-67-5 appears in our catalog under these names: Anthracene-9,10-dimethanamine, 95%, 9,10-Anthracenedimethanamine, 95-<97%, Anthracene-9,10-diyldimethanamine 95%. Offered by: Combi-blocks, Hoffman Fine Chemicals, Ambeed. Available pack sizes: 250mg, 10g, 5g, 1g, 25g, 50g, 100g, 200g.
[10-(aminomethyl)anthracen-9-yl]methanamine (CAS 6705-67-5) is a chemical compound with the molecular formula C16H16N2 and a molecular weight of 236.31 g/mol. IUPAC name: [10-(aminomethyl)anthracen-9-yl]methanamine. InChIKey: NNAIIURJGYYAKE-UHFFFAOYSA-N.
| Molecular formula | C16H16N2 |
|---|---|
| Molecular weight | 236.31 g/mol |
| IUPAC name | [10-(aminomethyl)anthracen-9-yl]methanamine |
| InChIKey | NNAIIURJGYYAKE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C3C=CC=CC3=C2CN)CN |
Computed by PubChem (NCBI)