CAS 5027-78-1 appears in our catalog under these names: 2-(1H-Indol-3-yl)-2-phenylethanamine acetate, 95%, 2-(1H-Indol-3-yl)-2-phenylethanamine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg, 10g.
2-(1H-indol-3-yl)-2-phenylethanamine (CAS 5027-78-1) is a chemical compound with the molecular formula C16H16N2 and a molecular weight of 236.31 g/mol. IUPAC name: 2-(1H-indol-3-yl)-2-phenylethanamine. InChIKey: HEBVBIGUNHPPLF-UHFFFAOYSA-N.
| Molecular formula | C16H16N2 |
|---|---|
| Molecular weight | 236.31 g/mol |
| IUPAC name | 2-(1H-indol-3-yl)-2-phenylethanamine |
| InChIKey | HEBVBIGUNHPPLF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(CN)C2=CNC3=CC=CC=C32 |
Computed by PubChem (NCBI)