Products 1217036-71-9
CAS 1217036-71-9 appears in our catalog under these names: Oxypurinol-13C-15N2, 4,6-Dihydroxypyrazolo(3,4-d)pyrimidine-13C,15N2, Oxypurinol-13C,15N2-1. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 5 mg, 1 mg, 500 μg.
1,7-dihydro(313C,1,2-15N2)pyrazolo[5,4-d]pyrimidine-4,6-dione (CAS 1217036-71-9) is a chemical compound with the molecular formula C5H4N4O2 and a molecular weight of 155.09 g/mol. IUPAC name: 1,7-dihydro(313C,1,2-15N2)pyrazolo[5,4-d]pyrimidine-4,6-dione. InChIKey: HXNFUBHNUDHIGC-ZDDXGAPTSA-N.
| Molecular formula | C5H4N4O2 |
|---|---|
| Molecular weight | 155.09 g/mol |
| IUPAC name | 1,7-dihydro(313C,1,2-15N2)pyrazolo[5,4-d]pyrimidine-4,6-dione |
| InChIKey | HXNFUBHNUDHIGC-ZDDXGAPTSA-N |
| SMILES | [13CH]1=[15N][15NH]C2=C1C(=O)NC(=O)N2 |
Computed by PubChem (NCBI)