CAS 151599-40-5 appears in our catalog under these names: 1-Methyl-4-nitro-1h-pyrazole-3-carbonitrile, 95%, 1-Methyl-4-nitro-1H-pyrazole-3-carbonitrile, 95+%, 1–Methyl–4–nitro–1h–pyrazole–3–carbonitrile, 1-Methyl-4-nitro-1H-pyrazole-3-carbonitrile. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth. Available pack sizes: 5g, 1g, 100mg, 250mg.
1-methyl-4-nitropyrazole-3-carbonitrile (CAS 151599-40-5) is a chemical compound with the molecular formula C5H4N4O2 and a molecular weight of 152.11 g/mol. IUPAC name: 1-methyl-4-nitropyrazole-3-carbonitrile. InChIKey: MVTSLZIUHFKPMJ-UHFFFAOYSA-N.
| Molecular formula | C5H4N4O2 |
|---|---|
| Molecular weight | 152.11 g/mol |
| IUPAC name | 1-methyl-4-nitropyrazole-3-carbonitrile |
| InChIKey | MVTSLZIUHFKPMJ-UHFFFAOYSA-N |
| SMILES | CN1C=C(C(=N1)C#N)[N+](=O)[O-] |
Computed by PubChem (NCBI)