Products 161770-53-2
CAS 161770-53-2 appears in our catalog under these names: Xanthine-15N2, 95%, Xanthine-15N2, 99.35%. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, 1 mg, 5 mg.
3,7-dihydropurine-2,6-dione (CAS 161770-53-2) is a chemical compound with the molecular formula C5H4N4O2 and a molecular weight of 154.10 g/mol. IUPAC name: 3,7-dihydropurine-2,6-dione. InChIKey: LRFVTYWOQMYALW-IOOOXAEESA-N.
| Molecular formula | C5H4N4O2 |
|---|---|
| Molecular weight | 154.10 g/mol |
| IUPAC name | 3,7-dihydropurine-2,6-dione |
| InChIKey | LRFVTYWOQMYALW-IOOOXAEESA-N |
| SMILES | C1=NC2=C(N1)C(=O)[15NH]C(=O)[15NH]2 |
Computed by PubChem (NCBI)
Synonyms:
Xanthine-15N2, orb3138651