Products 121739-61-5

CAS 121739-61-5 is the registry number for 4-Ethenylbenzenepentanoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.

Structural formula: {0} (CAS {1})

5-(4-ethenylphenyl)pentanoic acid (CAS 121739-61-5) is a chemical compound with the molecular formula C13H16O2 and a molecular weight of 204.26 g/mol. IUPAC name: 5-(4-ethenylphenyl)pentanoic acid. InChIKey: KHUYUPYDGZTBIT-UHFFFAOYSA-N.

Identity
Molecular formulaC13H16O2
Molecular weight204.26 g/mol
IUPAC name5-(4-ethenylphenyl)pentanoic acid
InChIKeyKHUYUPYDGZTBIT-UHFFFAOYSA-N
SMILESC=CC1=CC=C(C=C1)CCCCC(=O)O

Computed by PubChem (NCBI)