Products 1217442-24-4
CAS 1217442-24-4 is the registry number for (S)-4-N-Boc-2-hydroxymethyl-piperazine hydrochloride, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Tert-butyl (3S)-3-(hydroxymethyl)piperazine-1-carboxylate;hydrochloride (CAS 1217442-24-4) is a chemical compound with the molecular formula C10H21ClN2O3 and a molecular weight of 252.74 g/mol. IUPAC name: tert-butyl (3S)-3-(hydroxymethyl)piperazine-1-carboxylate;hydrochloride. InChIKey: LSYNNDZVKFLQDE-QRPNPIFTSA-N.
| Molecular formula | C10H21ClN2O3 |
|---|---|
| Molecular weight | 252.74 g/mol |
| IUPAC name | tert-butyl (3S)-3-(hydroxymethyl)piperazine-1-carboxylate;hydrochloride |
| InChIKey | LSYNNDZVKFLQDE-QRPNPIFTSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN[C@@H](C1)CO.Cl |
Computed by PubChem (NCBI)