CAS 1630907-19-5 appears in our catalog under these names: Trans-3-amino-1-boc-4-hydroxypiperidine hydrochloride, 95%, (3R,4R)-rel-tert-Butyl 3-amino-4-hydroxypiperidine-1-carboxylate hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
Tert-butyl (3R,4R)-3-amino-4-hydroxypiperidine-1-carboxylate;hydrochloride (CAS 1630907-19-5) is a chemical compound with the molecular formula C10H21ClN2O3 and a molecular weight of 252.74 g/mol. IUPAC name: tert-butyl (3R,4R)-3-amino-4-hydroxypiperidine-1-carboxylate;hydrochloride. InChIKey: LBNDPMQUQHWZIB-SCLLHFNJSA-N.
| Molecular formula | C10H21ClN2O3 |
|---|---|
| Molecular weight | 252.74 g/mol |
| IUPAC name | tert-butyl (3R,4R)-3-amino-4-hydroxypiperidine-1-carboxylate;hydrochloride |
| InChIKey | LBNDPMQUQHWZIB-SCLLHFNJSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]([C@@H](C1)N)O.Cl |
Computed by PubChem (NCBI)