Products 1414958-25-0

CAS 1414958-25-0 is the registry number for tert-Butyl 6-amino-1,4-oxazepane-4-carboxylate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl 6-amino-1,4-oxazepane-4-carboxylate;hydrochloride (CAS 1414958-25-0) is a chemical compound with the molecular formula C10H21ClN2O3 and a molecular weight of 252.74 g/mol. IUPAC name: tert-butyl 6-amino-1,4-oxazepane-4-carboxylate;hydrochloride. InChIKey: DKKCZPHHNGTSJD-UHFFFAOYSA-N.

Identity
Molecular formulaC10H21ClN2O3
Molecular weight252.74 g/mol
IUPAC nametert-butyl 6-amino-1,4-oxazepane-4-carboxylate;hydrochloride
InChIKeyDKKCZPHHNGTSJD-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCOCC(C1)N.Cl

Computed by PubChem (NCBI)