CAS 1217464-82-8 is the registry number for (2R)-2-{((tert-Butoxy)carbonyl)amino}hex-5-ynoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hex-5-ynoic acid (CAS 1217464-82-8) is a chemical compound with the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. IUPAC name: (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hex-5-ynoic acid. InChIKey: DPHIBCOGEUVKGB-MRVPVSSYSA-N.
| Molecular formula | C11H17NO4 |
|---|---|
| Molecular weight | 227.26 g/mol |
| IUPAC name | (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hex-5-ynoic acid |
| InChIKey | DPHIBCOGEUVKGB-MRVPVSSYSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CCC#C)C(=O)O |
Computed by PubChem (NCBI)