CAS 1217500-80-5 appears in our catalog under these names: 2-(Chloromethyl)-5-nitrophenylboronic acid, 95%, (2-(Chloromethyl)-5-nitrophenyl)boronic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g, 100mg.
[2-(chloromethyl)-5-nitrophenyl]boronic acid (CAS 1217500-80-5) is a chemical compound with the molecular formula C7H7BClNO4 and a molecular weight of 215.40 g/mol. IUPAC name: [2-(chloromethyl)-5-nitrophenyl]boronic acid. InChIKey: BUTLINWGOGSREG-UHFFFAOYSA-N.
| Molecular formula | C7H7BClNO4 |
|---|---|
| Molecular weight | 215.40 g/mol |
| IUPAC name | [2-(chloromethyl)-5-nitrophenyl]boronic acid |
| InChIKey | BUTLINWGOGSREG-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)[N+](=O)[O-])CCl)(O)O |
Computed by PubChem (NCBI)